![2-[(5-Chloro-2-nitrophenyl)sulfanyl]-1,3-benzothiazole structure](/static/products/620/62049-84-7.png)
2-[(5-Chloro-2-nitrophenyl)sulfanyl]-1,3-benzothiazole
2-(5-chloro-2-nitrophenyl)sulfanyl-1,3-benzothiazole
Also Known As: BAS 00805361|2-(5-chloro-2-nitrophenyl)sulfanyl-1,3-benzothiazole|2-benzothiazol-2-ylthio-4-chloro-1-nitrobenzene|2-((5-chloro-2-nitrophenyl)thio)benzo[d]thiazole|2-(5-Chloro-2-nitro-phenylsulfanyl)-benzothiazole|2-[(5-chloro-2-nitrophenyl)sulfanyl]-1,3-benzothiazole|AG-670/12031064|SR-01000421732-1|2-({5-chloro-2-nitrophenyl}sulfanyl)-1,3-benzothiazole
| Molecular Formula | C13H7ClN2O2S2 |
|---|---|
| Molecular Weight | 321.96375 g/mol |
| LogP | 5.2 |
| Topological Polar Surface Area | 112.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 321.96375 |
| Monoisotopic Mass | 321.96375 |
| Heavy Atoms | 20 |
| Complexity | 369.0 |
Chemical Identifiers
| CAS Number | 62049-84-7 |
|---|---|
| SMILES | C1=CC=C2C(=C1)N=C(S2)SC3=C(C=CC(=C3)Cl)[N+](=O)[O-] |
| InChIKey | FKAWEPWMMORCEJ-UHFFFAOYSA-N |
Product Overview
2-[(5-Chloro-2-nitrophenyl)sulfanyl]-1,3-benzothiazole (CAS 62049-84-7), with molecular formula C13H7ClN2O2S2 and molecular weight 321.96375 g/mol. IUPAC: 2-(5-chloro-2-nitrophenyl)sulfanyl-1,3-benzothiazole.
2-[(5-Chloro-2-nitrophenyl)sulfanyl]-1,3-benzothiazole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »