AC1NNBSG
2-methoxyethyl 2,7-dimethyl-5-(4-methylphenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Also Known As: 2-methoxyethyl 2,7-dimethyl-5-(4-methylphenyl)-3-oxo-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate|2-methoxyethyl 2,7-dimethyl-5-(4-methylphenyl)-3-oxo-2H,3H,5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate|2-methoxyethyl 2,7-dimethyl-5-(4-methylphenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate|2methoxyethyl 2,7dimethyl5(4methylphenyl)3oxo2,3dihydro5h[1,3]thiazolo[3,2a]pyrimidine6carboxylate
| Molecular Formula | C19H22N2O4S |
|---|---|
| Molecular Weight | 374.13004 g/mol |
| LogP | 2.83322 |
| Topological Polar Surface Area | 68.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 374.13004 |
| Monoisotopic Mass | 374.13004 |
| Heavy Atoms | 26 |
| Complexity | 785.23376 |
Chemical Identifiers
| CAS Number | 620552-29-6 |
|---|---|
| SMILES | CC1C(=O)N2C(C(=C(N=C2S1)C)C(=O)OCCOC)C3=CC=C(C=C3)C |
Product Overview
AC1NNBSG (CAS 620552-29-6), with molecular formula C19H22N2O4S and molecular weight 374.13004 g/mol. IUPAC: 2-methoxyethyl 2,7-dimethyl-5-(4-methylphenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
AC1NNBSG is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »