![3-chloro-N-{4-[(diallylamino)sulfonyl]phenyl}-1-benzothiophene-2-carboxamide structure](/static/products/6205/620581-31-9.webp)
3-chloro-N-{4-[(diallylamino)sulfonyl]phenyl}-1-benzothiophene-2-carboxamide
N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-chloro-1-benzothiophene-2-carboxamide
Also Known As: KS-000040PE|AN-329/42217159|3-chloro-N-{4-[(diallylamino)sulfonyl]phenyl}-1-benzothiophene-2-carboxamide|N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-chloro-1-benzothiophene-2-carboxamide|3-chloro-N-[4-(diprop-2-en-1-ylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide
| Molecular Formula | C21H19ClN2O3S2 |
|---|---|
| Molecular Weight | 446.05255 g/mol |
| LogP | 5.1697 |
| Topological Polar Surface Area | 66.48 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Exact Mass | 446.05255 |
| Monoisotopic Mass | 446.05255 |
| Heavy Atoms | 29 |
| Complexity | 1158.3593 |
Chemical Identifiers
| CAS Number | 620581-31-9 |
|---|---|
| SMILES | C=CCN(CC=C)S(=O)(=O)C1=CC=C(C=C1)NC(=O)C2=C(C3=CC=CC=C3S2)Cl |
Product Overview
3-chloro-N-{4-[(diallylamino)sulfonyl]phenyl}-1-benzothiophene-2-carboxamide (CAS 620581-31-9), with molecular formula C21H19ClN2O3S2 and molecular weight 446.05255 g/mol. IUPAC: N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-chloro-1-benzothiophene-2-carboxamide.
3-chloro-N-{4-[(diallylamino)sulfonyl]phenyl}-1-benzothiophene-2-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »