Phenethylamine, N-cyanomethyl-beta-methoxy-m-trifluoromethyl-, hydrochloride
2-[[2-methoxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]acetonitrile;hydrochloride
Also Known As: N-Cyanomethyl-beta-methoxy-m-trifluoromethylphenethylamine hydrochloride|Phenethylamine, N-cyanomethyl-beta-methoxy-m-trifluoromethyl-, hydrochloride|Acetonitrile, ((2-methoxy-2-(3-(trifluoromethyl)phenyl)ethyl)amino)-, monohydrochloride|({2-Methoxy-2-[3-(trifluoromethyl)phenyl]ethyl}amino)acetonitrile--hydrogen chloride (1/1)|2-[[2-methoxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]acetonitrile hydrochloride
| Molecular Formula | C12H14ClF3N2O |
|---|---|
| Molecular Weight | 294.07468 g/mol |
| LogP | 2.92788 |
| Topological Polar Surface Area | 45.05 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 294.07468 |
| Monoisotopic Mass | 294.07468 |
| Heavy Atoms | 19 |
| Complexity | 431.71805 |
Chemical Identifiers
| CAS Number | 62064-71-5 |
|---|---|
| SMILES | COC(CNCC#N)C1=CC(=CC=C1)C(F)(F)F.Cl |
Product Overview
Phenethylamine, N-cyanomethyl-beta-methoxy-m-trifluoromethyl-, hydrochloride (CAS 62064-71-5), with molecular formula C12H14ClF3N2O and molecular weight 294.07468 g/mol. IUPAC: 2-[[2-methoxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]acetonitrile;hydrochloride.