Ethyl 3-(naphthalen-8-yl)-3-oxopropanoate
ethyl 3-naphthalen-1-yl-3-oxopropanoate
Also Known As: ethyl 3-(naphthalen-1-yl)-3-oxopropanoate|ethyl 3-(naphthalen-8-yl)-3-oxopropanoate|ethyl 1-naphthoylacetate|ethyl (1-naphthoyl)acetate|ethyl 3-naphthalen-1-yl-3-oxopropanoate|KS-00001KJL|3-Naphthalen-1-yl-3-oxo-propionic acid ethyl ester|1-Naphthalenepropanoic acid, b-oxo-, ethyl ester|b-Oxo-1-naphthalenepropanoic acid ethyl ester|ethyl 3-(1-naphthyl)-3-oxo-propanoate|1-Naphthalenepropanoicacid, b-oxo-, ethyl ester|AC-7792|AN-8608|ethyl-3-(1-naphthyl)-3-oxopropanoate|3,4-DIBROMOBENZENESULFONYLCHLORIDE|ethyl3-(naphthalen-1-yl)-3-oxopropanoate|3-naphthalen-1-yl-3-oxopropionic acid ethyl ester|beta-oxo-1-naphthalenepropanoic acid ethyl ester|071N765|3-naphthalen-1-yl-3-oxopropanoic acid ethyl ester|ETHYL 3-(NAPHTHALEN-8-YL)-3- OXOPROPANOATE|I14-15147|3-NAPHTHALEN-1-YL-3-OXO-PROPIONICACIDETHYLESTER
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.0943 g/mol |
| LogP | 2.9757 |
| Topological Polar Surface Area | 43.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 242.0943 |
| Monoisotopic Mass | 242.0943 |
| Heavy Atoms | 18 |
| Complexity | 581.81335 |
Chemical Identifiers
| CAS Number | 62071-76-5 |
|---|---|
| SMILES | CCOC(=O)CC(=O)C1=CC=CC2=CC=CC=C21 |
Product Overview
Ethyl 3-(naphthalen-8-yl)-3-oxopropanoate (CAS 62071-76-5), with molecular formula C15H14O3 and molecular weight 242.0943 g/mol. IUPAC: ethyl 3-naphthalen-1-yl-3-oxopropanoate.