(1R,3S,4S,5S,7S)-rel-4-Aminoadamantan-1-ol
(3S,5R)-4-aminoadamantan-1-ol
Also Known As: 2-aminoadamantane-5-ol|4-aminoadamantan-1-ol|Adamantane Impurity 13|Adamantane Impurity 16|4-Aminoadamantane-1-ol|Cis-4-aminoadamantan-1-ol|4-amino-1-adamantanol;|trans-4-Aminoadamantan-1-ol|Vildagliptin Impurity 123|Z-5-hydroxy-2-adamantamine|5-hydroxy-2-adamantanamine;|syn-4-aminoadamantan-1-ol;|(3R,5S)-4-aminoadamantan-1-ol|Trans-4-Amino-1-hydroxy-adamantane|(E)-5-hydroxy-2-aminoadamantane|(E)-5-hydroxy-2-aminoadamantane;|(1R,3S,4S,5S,7S)-rel-4-Aminoadamantan-1-ol|(1s,3R,5S,7s)-4-aminoadamantan-1-ol|(3R,5S,7s)-4-aminoadamantan-1-ol|GS-4192|SDCCGMLS-0064885.P001
| Molecular Formula | C10H17NO |
|---|---|
| Molecular Weight | 167.13101 g/mol |
| LogP | 0.8847 |
| Topological Polar Surface Area | 46.25 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 167.13101 |
| Monoisotopic Mass | 167.13101 |
| Heavy Atoms | 12 |
| Complexity | 199.88412 |
Chemical Identifiers
| CAS Number | 62075-23-4 |
|---|---|
| SMILES | C1[C@@H]2CC3(C[C@@H](C2N)CC1C3)O |
Product Overview
(1R,3S,4S,5S,7S)-rel-4-Aminoadamantan-1-ol (CAS 62075-23-4), with molecular formula C10H17NO and molecular weight 167.13101 g/mol. IUPAC: (3S,5R)-4-aminoadamantan-1-ol.