1,3-Cyclobutanedione, 2,4-bis(triphenylphosphoranylidene)-
2,4-bis(triphenyl-λ5-phosphanylidene)cyclobutane-1,3-dione
Also Known As: 2,4-bis(triphenyl-|1,3-Cyclobutanedione, 2,4-bis(triphenylphosphoranylidene)-|1,3-Cyclobutanedione,2,4-bis(triphenylphosphoranylidene)|2,4-Bis(triphenylphosphoranylidene)-1,3-cyclobutanedione|2,4-Bis(triphenylphosphoranylidene)-1,3-cyclobutanedione #|2,4-bis(triphenyl-|E5-phosphanylidene)cyclobutane-1,3-dione|2,4-Bis(triphenyl-lambda~5~-phosphanylidene)cyclobutane-1,3-dione
| Molecular Formula | C40H30O2P2 |
|---|---|
| Molecular Weight | 604.1721 g/mol |
| LogP | 7.5 |
| Topological Polar Surface Area | 34.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 604.1721 |
| Monoisotopic Mass | 604.1721 |
| Heavy Atoms | 44 |
| Complexity | 913.0 |
Chemical Identifiers
| CAS Number | 62085-96-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(=C2C(=O)C(=P(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C2=O)(C6=CC=CC=C6)C7=CC=CC=C7 |
| InChIKey | PMOMFTOFLMXZIG-UHFFFAOYSA-N |
Product Overview
1,3-Cyclobutanedione, 2,4-bis(triphenylphosphoranylidene)- (CAS 62085-96-5), with molecular formula C40H30O2P2 and molecular weight 604.1721 g/mol. IUPAC: 2,4-bis(triphenyl-λ5-phosphanylidene)cyclobutane-1,3-dione.
1,3-Cyclobutanedione, 2,4-bis(triphenylphosphoranylidene)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »