2-Methyl-3-(trifluoromethyl)benzoic acid
2-methyl-3-(trifluoromethyl)benzoic acid
Also Known As: 2-methyl-3-(trifluoromethyl)benzoic Acid|2-Methyl-3-trifluoromethylbenzoic acid|ACMC-209ws1|3-Carboxy-2-methylbenzotrifluoride|WT040|JRD-0928|KS-000010XB|2-Carboxy-6-(trifluoromethyl)toluene|3-trifluoromethyl-2-methybenzoic acid|3-trifluoromethyl-2-methylbenzoic acid|Benzoic acid, 2-methyl-3-(trifluoromethyl)-|AC-9039|AN-7423|CS-W015434|PS-8149|2-methyl-3-trifluoromethyl-benzoic acid|2-methyl-3-(trifluoromethyl)-benzoic acid|2-methyl-3-(trifluoromethyl)benzoic acid;|2-METHYL-3-(TRIFLUOROMETHYL)BENZOICACID|Benzoic acid,2-methyl-3-(trifluoromethyl)-
| Molecular Formula | C9H7F3O2 |
|---|---|
| Molecular Weight | 204.03981 g/mol |
| LogP | 2.71202 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 204.03981 |
| Monoisotopic Mass | 204.03981 |
| Heavy Atoms | 14 |
| Complexity | 368.8101 |
Chemical Identifiers
| CAS Number | 62089-35-4 |
|---|---|
| SMILES | CC1=C(C=CC=C1C(F)(F)F)C(=O)O |
Product Overview
2-Methyl-3-(trifluoromethyl)benzoic acid (CAS 62089-35-4), with molecular formula C9H7F3O2 and molecular weight 204.03981 g/mol. IUPAC: 2-methyl-3-(trifluoromethyl)benzoic acid.