(4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid
(4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid
Also Known As: (4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid|BAS 01363405|(R)-2-Phenyl-4,5-dihydrothiazole-4-carboxylic acid|2-Phenyl-4,5-dihydrothiazole-4-carboxylic acid|(R)-2-Phenyl-4-carboxy-4,5-dihydrothiazole|J3.240.701C|(4R)-2-Phenyl-4,5-dihydro-thiazole-4-carboxylic acid|(R)-2-Phenyl-2-thiazoline-4alpha-carboxylic acid|(R)-2-Phenyl-4,5-dihydrothiazole-4-carboxylicacid|4-Thiazolecarboxylic acid, 4,5-dihydro-2-phenyl-, (4R)-|4-Thiazolecarboxylic acid, 4,5-dihydro-2-phenyl-, (R)-
| Molecular Formula | C10H9NO2S |
|---|---|
| Molecular Weight | 207.0354 g/mol |
| LogP | 1.6332 |
| Topological Polar Surface Area | 49.66 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 207.0354 |
| Monoisotopic Mass | 207.0354 |
| Heavy Atoms | 14 |
| Complexity | 374.9682 |
Chemical Identifiers
| CAS Number | 62096-93-9 |
|---|---|
| SMILES | C1[C@H](N=C(S1)C2=CC=CC=C2)C(=O)O |
Product Overview
(4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 62096-93-9), with molecular formula C10H9NO2S and molecular weight 207.0354 g/mol. IUPAC: (4R)-2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid.