![Benzenamine, 4-methoxy-N-[(5-nitro-2-thienyl)methylene]- structure](/static/products/6212/62128-01-2.webp)
Benzenamine, 4-methoxy-N-[(5-nitro-2-thienyl)methylene]-
N-(4-methoxyphenyl)-1-(5-nitrothiophen-2-yl)methanimine
Also Known As: Benzenamine, 4-methoxy-N-[(5-nitro-2-thienyl)methylene]-|N-(4-methoxyphenyl)-1-(5-nitrothiophen-2-yl)methanimine|N-(5-Nitro-2-thienylmethylene)-4-methoxybenzenamine|SR-01000198312-1|Benzenamine,4-methoxy-N-[(5-nitro-2-thienyl)methylene]|(E)-N-(4-Methoxyphenyl)-1-(5-nitrothiophen-2-yl)methanimine|4-Methoxy-N-[(E)-(5-nitrothiophen-2-yl)methylidene]aniline
| Molecular Formula | C12H10N2O3S |
|---|---|
| Molecular Weight | 262.0412 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 95.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 262.0412 |
| Monoisotopic Mass | 262.0412 |
| Heavy Atoms | 18 |
| Complexity | 311.0 |
Chemical Identifiers
| CAS Number | 62128-01-2 |
|---|---|
| SMILES | COC1=CC=C(C=C1)N=CC2=CC=C(S2)[N+](=O)[O-] |
| InChIKey | ZEIZMTUGHVTKTO-UHFFFAOYSA-N |
Product Overview
Benzenamine, 4-methoxy-N-[(5-nitro-2-thienyl)methylene]- (CAS 62128-01-2), with molecular formula C12H10N2O3S and molecular weight 262.0412 g/mol. IUPAC: N-(4-methoxyphenyl)-1-(5-nitrothiophen-2-yl)methanimine.
Benzenamine, 4-methoxy-N-[(5-nitro-2-thienyl)methylene]- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »