2-oxohexahydro-2H-3,5-methanocyclopenta[b]furan-7-carboxylic acid
5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid
Also Known As: oxo[?]carboxylic acid|3, hexahydro-2-oxo-, stereoisomer|2-oxohexahydro-2H-3,5-methanocyclopenta[b]furan-7-carboxylic acid|5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid|NORBORNANEDICARBOXYLIC ACID, Y-LACTONE|AK-918/43403712|NORBORNANEDICARBOXYLIC ACID, 5-HYDROXY-, Y-LACTONE|5-oxo-4-oxatricyclo[4.2.1.0~3,7~]nonane-9-carboxylic acid|Norbornanedicarboxylic acid, 5-hydroxy-, gamma-lactone|5-oxo-4-oxatricyclo[4.2.1.0?,?]nonane-9-carboxylic acid|hexahydro-2-oxo-3,5-methano-2h-cyclopenta[b]furan-7-carboxylic acid|5-HYDROXY-2,3-NORBORNANEDICARBOXYLIC ACID GAMMA-LACTONE|3, hexahydro-2-oxo-, (3.alpha.,3a.beta.,5.alpha.,6a.beta.,7S*)-|3,5-Methano-2H-cyclopenta[b]furan-7-carboxylic acid, hexahydro-2-oxo-, (3.alpha.,3a.beta.,5.alpha.,6a.beta.,7S*)-
| Molecular Formula | C9H10O4 |
|---|---|
| Molecular Weight | 182.0579 g/mol |
| LogP | 0.2 |
| Topological Polar Surface Area | 63.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 182.0579 |
| Monoisotopic Mass | 182.0579 |
| Heavy Atoms | 13 |
| Complexity | 298.0 |
Chemical Identifiers
| CAS Number | 623-60-9 |
|---|---|
| SMILES | C1C2CC3C1C(C2C(=O)O)C(=O)O3 |
| InChIKey | HAQPSNHNVBEWRO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-oxohexahydro-2H-3,5-methanocyclopenta[b]furan-7-carboxylic acid (CAS 623-60-9), with molecular formula C9H10O4 and molecular weight 182.0579 g/mol. IUPAC: 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid.