2-Butenedioic acid, (Z)-, bis(2-ethoxyethyl) ester
bis(2-ethoxyethyl) (E)-but-2-enedioate
Also Known As: Bis(2-ethoxyethyl) fumarate|BIS FUMARATE|Bis(2-ethoxyethyl) maleate|bis-(2-Ethoxyethyl) fumarate|EINECS 256-207-3|bis-(2-ethoxy-ethyl)-fumarate|Bis-(2-aethoxy-aethyl)-fumarat|EINECS 210-818-1|AI3-03533|AI3-00663|Fumaric acid, di(2-ethoxyethyl) ester|bis(2-ethoxyethyl) (E)-but-2-enedioate|Bis(2-ethoxyethyl) (2E)-but-2-enedioate|2-Butenedioic acid, (Z)-, bis(2-ethoxyethyl) ester|2-Butenedioic acid, (E)-, bis(2-ethoxyethyl) ester|(E)-2-Butenedioic acid bis(2-ethoxyethyl) ester|2-Butenedioic acid (2E)-, bis(2-ethoxyethyl) ester|1,4-BIS(2-ETHOXYETHYL) (2E)-BUT-2-ENEDIOATE
| Molecular Formula | C12H20O6 |
|---|---|
| Molecular Weight | 260.12598 g/mol |
| LogP | 0.702 |
| Topological Polar Surface Area | 71.06 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Exact Mass | 260.12598 |
| Monoisotopic Mass | 260.12598 |
| Heavy Atoms | 18 |
| Complexity | 235.29324 |
Chemical Identifiers
| CAS Number | 623-90-5 |
|---|---|
| SMILES | CCOCCOC(=O)/C=C/C(=O)OCCOCC |
Product Overview
2-Butenedioic acid, (Z)-, bis(2-ethoxyethyl) ester (CAS 623-90-5), with molecular formula C12H20O6 and molecular weight 260.12598 g/mol. IUPAC: bis(2-ethoxyethyl) (E)-but-2-enedioate.