1-Acetyl-5-bromo-7-nitroindoline
1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)ethanone
Also Known As: 1-Acetyl-5-bromo-7-nitroindoline|1-(5-bromo-7-nitroindolin-1-yl)ethanone|ACMC-1BFXP|Oprea1_712810|1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)ethanone|N-ACETYL-5-BROMO-7-NITRO-INDOLINE|TPL0077|N-acetyl-5-bromo-7-nitroindoline|1-ACETYL-5-BROMO-7-NITROINDOLE|CA-299|1-ACETYL-5-BROMO-7-NITRO-2,3-DIHYDRO-1H-INDOLE|5-tert-Butyl 1-methyl L-glutamate hydrochloride|1-(5-Bromo-4-nitroindolin-1-yl)ethanone|1-(5-Bromo-7-nitro-1-indolinyl)ethanone|1-(5-bromo-7-nitro-indolin-1-yl)ethanone|1-Acetyl-5-bromo-7-nitroindoline, >=98%
| Molecular Formula | C10H9BrN2O3 |
|---|---|
| Molecular Weight | 283.97964 g/mol |
| LogP | 2.2663 |
| Topological Polar Surface Area | 63.45 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 283.97964 |
| Monoisotopic Mass | 283.97964 |
| Heavy Atoms | 16 |
| Complexity | 487.19763 |
Chemical Identifiers
| CAS Number | 62368-07-4 |
|---|---|
| SMILES | CC(=O)N1CCC2=C1C(=CC(=C2)Br)[N+](=O)[O-] |
Product Overview
1-Acetyl-5-bromo-7-nitroindoline (CAS 62368-07-4), with molecular formula C10H9BrN2O3 and molecular weight 283.97964 g/mol. IUPAC: 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)ethanone.