Hexamethyl Benzenehexacarboxylate
hexamethyl benzene-1,2,3,4,5,6-hexacarboxylate
Also Known As: Hexamethyl benzenehexacarboxylate|Hexamethyl mellitate|Benzenehexacarboxylic Acid Hexamethyl Ester|Mellitic acid hexamethyl|ACMC-1BA1K|hexamethyl benzene-1,2,3,4,5,6-hexacarboxylate|BENZENEHEXACARBOXYLICACIDHEXAMETHYLESTER|Benzenehexacarboxylic acid, hexamethyl ester|Mellitic acid, hexamethyl ester|Mellitic Acid Hexamethyl Ester|Benzenehexacarboxylic acid hexamethyl|Hexamethyl 1,2,3,4,5,6-benzenehexacarboxylate|Hexamethyl 1,2,3,4,5,6-benzenehexacarboxylate #|I14-62765|1,2,3,4,5,6-hexamethyl benzene-1,2,3,4,5,6-hexacarboxylate|1,2,3,4,5,6-Benzenehexakis(carboxylic acid methyl) ester|Benzene-1,2,3,4,5,6-hexa(carboxylic acid methyl) ester|Benzene-1,2,3,4,5,6-hexacarboxylic acid hexamethyl ester|677-968-1
| Molecular Formula | C18H18O12 |
|---|---|
| Molecular Weight | 426.07983 g/mol |
| LogP | 1.0 |
| Topological Polar Surface Area | 158.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Exact Mass | 426.07983 |
| Monoisotopic Mass | 426.07983 |
| Heavy Atoms | 30 |
| Complexity | 547.0 |
Chemical Identifiers
| CAS Number | 6237-59-8 |
|---|---|
| SMILES | COC(=O)C1=C(C(=C(C(=C1C(=O)OC)C(=O)OC)C(=O)OC)C(=O)OC)C(=O)OC |
| InChIKey | BQLICNRRYLYEDI-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Hexamethyl Benzenehexacarboxylate (CAS 6237-59-8), with molecular formula C18H18O12 and molecular weight 426.07983 g/mol. IUPAC: hexamethyl benzene-1,2,3,4,5,6-hexacarboxylate.