(2,2-Dimethylpropoxy)(dimethyl)(pentafluorophenyl)silane
2,2-dimethylpropoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane
Also Known As: 2,2-Dimethyl-1-dimethyl(pentafluorophenyl)silyloxypropane|(2,2-Dimethylpropoxy)(dimethyl)(pentafluorophenyl)silane|2,2-dimethylpropoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane|(2,2-Dimethylpropoxy)di(methyl)(pentafluorophenyl)silane|Alanine,3-[bis(carboxymethyl)amino]-N,N-bis(carboxymethyl)|Silane, (2,2-dimethylpropoxy)dimethyl(pentafluorophenyl)-|Dimethyl (2,3,4,5,6-pentafluorophenyl)silyl neopentyl ether|Dimethyl(2,3,4,5,6-pentafluorophenyl)silyl neopentyl ether #
| Molecular Formula | C13H17F5OSi |
|---|---|
| Molecular Weight | 312.0969 g/mol |
| LogP | 3.8569 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 312.0969 |
| Monoisotopic Mass | 312.0969 |
| Heavy Atoms | 20 |
| Complexity | 317.0 |
Chemical Identifiers
| CAS Number | 62394-64-3 |
|---|---|
| SMILES | CC(C)(C)CO[Si](C)(C)C1=C(C(=C(C(=C1F)F)F)F)F |
| InChIKey | UTJAXHWARXYUKA-UHFFFAOYSA-N |
Product Overview
(2,2-Dimethylpropoxy)(dimethyl)(pentafluorophenyl)silane (CAS 62394-64-3), with molecular formula C13H17F5OSi and molecular weight 312.0969 g/mol. IUPAC: 2,2-dimethylpropoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
(2,2-Dimethylpropoxy)(dimethyl)(pentafluorophenyl)silane is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »