AC1L6LT7
5-chloro-2-[(4-chlorophenoxy)methyl]-3-[(4-methylphenyl)sulfanylmethyl]-1-benzothiophene
Also Known As: KST-1A6678|(5-chloro-3-{[(4-methylphenyl)sulfanyl]methyl}-1-benzothiophen-2-yl)methyl 4-chlorophenyl ether|5-chloro-2-[(4-chlorophenoxy)methyl]-3-[(4-methylphenyl)sulf|5-chloro-2-[(4-chlorophenoxy)methyl]-3-[(4-methylphenyl)sulfanylmethyl]-1-benzothiophene|5-Chloro-2-[(4-chlorophenoxy)methyl]-3-{[(4-methylphenyl)sulfanyl]methyl}-1-benzothiophene
| Molecular Formula | C23H18Cl2OS2 |
|---|---|
| Molecular Weight | 444.0176 g/mol |
| LogP | 8.1 |
| Topological Polar Surface Area | 62.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 444.0176 |
| Monoisotopic Mass | 444.0176 |
| Heavy Atoms | 28 |
| Complexity | 477.0 |
Chemical Identifiers
| CAS Number | 6269-72-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)SCC2=C(SC3=C2C=C(C=C3)Cl)COC4=CC=C(C=C4)Cl |
| InChIKey | YSMLFPMIUJBZLO-UHFFFAOYSA-N |
Product Overview
AC1L6LT7 (CAS 6269-72-3), with molecular formula C23H18Cl2OS2 and molecular weight 444.0176 g/mol. IUPAC: 5-chloro-2-[(4-chlorophenoxy)methyl]-3-[(4-methylphenyl)sulfanylmethyl]-1-benzothiophene.
AC1L6LT7 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »