1,1-Dioxo-1lambda6-benzothiophene-3-carboxylic acid
1,1-dioxo-1-benzothiophene-3-carboxylic acid
Also Known As: Benzo[b]thiophene-3-carboxylic acid, 1,1-dioxide|1,1-dioxo-1-benzothiophene-3-carboxylic acid|1,1-dioxo-1lambda6-benzothiophene-3-carboxylic acid|1,1-dioxobenzothiophene-3-carboxylic Acid|1-benzothiophene-3-carboxylic acid 1,1-dioxide|benzo[b]thiophen-3-carboxylic acid 1,1-dioxide|AB-337/13036048|1,1-Dioxo-1H-1lambda~6~-benzothiophene-3-carboxylic acid|968-885-4
| Molecular Formula | C9H6O4S |
|---|---|
| Molecular Weight | 209.99867 g/mol |
| LogP | 0.8994 |
| Topological Polar Surface Area | 71.44 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 209.99867 |
| Monoisotopic Mass | 209.99867 |
| Heavy Atoms | 14 |
| Complexity | 539.6853 |
Chemical Identifiers
| CAS Number | 62761-72-2 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=CS2(=O)=O)C(=O)O |
Product Overview
1,1-Dioxo-1lambda6-benzothiophene-3-carboxylic acid (CAS 62761-72-2), with molecular formula C9H6O4S and molecular weight 209.99867 g/mol. IUPAC: 1,1-dioxo-1-benzothiophene-3-carboxylic acid.
1,1-Dioxo-1lambda6-benzothiophene-3-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »