tert-Butyl(dimethyl)(3-methylphenoxy)silane
tert-butyl-dimethyl-(3-methylphenoxy)silane
Also Known As: m-Cresol, TBDMS|Phenol, 3-methyl, DMTBS|m-Cresol, TBDMS derivative|tert-Butyl(dimethyl)(3-methylphenoxy)silane|tert-butyldimethyl(m-tolyloxy)silane|tert-butyl-dimethyl-(3-methylphenoxy)silane|(3-Methylphenoxy)tert-butyldimethylsilane|tert-butyldimethyl(3-methylphenoxy)silane|tert-Butyldi(methyl)(3-methylphenoxy)silane|tert-Butyldimethylsilyl 3-methylphenyl ether|3-Methyl-1-(tert-butyldimethylsiloxy)benzene|3-Methylphenyl(tert-butyldimethylsilyl) ether|tert-Butyl(dimethyl)(3-methylphenoxy)silane #|1-Dimethyl(tert-butyl)silyloxy-3-methylbenzene|3-[(1,1-Dimethylethyl)dimethylsilyl]oxytoluene|Benzene, 1-[(tert-butyldimethylsilyl)oxy]-3-methyl-|Silane, (1,1-dimethylethyl)dimethyl(3-methylphenoxy)-
| Molecular Formula | C13H22OSi |
|---|---|
| Molecular Weight | 222.144 g/mol |
| LogP | 4.37902 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 222.144 |
| Monoisotopic Mass | 222.144 |
| Heavy Atoms | 15 |
| Complexity | 205.0 |
Chemical Identifiers
| CAS Number | 62790-75-4 |
|---|---|
| SMILES | CC1=CC(=CC=C1)O[Si](C)(C)C(C)(C)C |
| InChIKey | HBUBRNBOYWHGHQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
tert-Butyl(dimethyl)(3-methylphenoxy)silane (CAS 62790-75-4), with molecular formula C13H22OSi and molecular weight 222.144 g/mol. IUPAC: tert-butyl-dimethyl-(3-methylphenoxy)silane.
tert-Butyl(dimethyl)(3-methylphenoxy)silane is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »