2H-Purine-2-thione, 6-amino-3,7-dihydro-, sulfate (1:?)
6-amino-1,7-dihydropurine-2-thione;sulfuric acid
Also Known As: 2-Thioadenine sulfate|2-Mercaptoadenine sulfate|6-Amino-2-hydroxypurine|EINECS 256-448-4|2H-Purine-2-thione, 6-amino-1,7-dihydro-, sulfate|6-Amino-1,7-dihydropurine-2-thione sulfate|1,7-Dihydro-2H-adenine-2-thione sulphate|2H-Purine-2-thione, 6-amino-, sulfate|1,7-Dihydro-2H-adenine-2-thione sulfate|2H-Purine-2-thione, 6-amino-1,3-dihydro-, sulfate (1:1)|2H-Purine-2-thione, 6-amino-3,7-dihydro-, sulfate (1:?)|6-amino-1,7-dihydropurine-2-thione,sulfuric acid|6-amino-1,7-dihydropurine-2-thione; sulfuric acid|6-Amino-1,7-dihydro-2H-purine-2-thione sulfate (1:1)|Sulfuric acid--6-amino-1,7-dihydro-2H-purine-2-thione (1/1)
| Molecular Formula | C5H7N5O4S2 |
|---|---|
| Molecular Weight | 264.99396 g/mol |
| LogP | -0.05511 |
| Topological Polar Surface Area | 157.98 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 0 |
| Exact Mass | 264.99396 |
| Monoisotopic Mass | 264.99396 |
| Heavy Atoms | 16 |
| Complexity | 636.1279 |
Chemical Identifiers
| CAS Number | 6281-92-1 |
|---|---|
| SMILES | C1=NC2=NC(=S)NC(=C2N1)N.OS(=O)(=O)O |
Product Overview
2H-Purine-2-thione, 6-amino-3,7-dihydro-, sulfate (1:?) (CAS 6281-92-1), with molecular formula C5H7N5O4S2 and molecular weight 264.99396 g/mol. IUPAC: 6-amino-1,7-dihydropurine-2-thione;sulfuric acid.