Reboxetine Mesylate
(2R)-2-[(R)-(2-ethoxyphenoxy)-phenylmethyl]morpholine;methanesulfonic acid
Also Known As: Reboxetine mesylate|Edronax|Reboxetine mesilate|Reboxetine|Prolift|Vestra|Reboxitine|Davedax|Reboxetine (mesylate)|Reboxetine mesylate;|Vestra (TN)|Prolift;Vestra;Norebox|Reboxetine mesylate [USAN]|Reboxetine methansulphonate|REBOXETINE METHANESULFONATE|Reboxetine methanesulphonate|Reboxetine [INN:BAN]|(R,R)-reboxetine (mesylate)|FCE 20124|(R,R)-Reboxetine mesylate|Reboxetine.methanesulfonic acid|PNU 155950E|Reboxetine mesylate (USAN)|(+/-)-Reboxetine Mesylate|(S,S)-reboxetine (mesylate)|PNU-155950E|MSK11177S|AOB2309|Reboxetine (mesylate) (Standard)|BH007
| Molecular Formula | C20H27NO6S |
|---|---|
| Molecular Weight | 409.1559 g/mol |
| LogP | 2.6978 |
| Topological Polar Surface Area | 102.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Exact Mass | 409.1559 |
| Monoisotopic Mass | 409.1559 |
| Heavy Atoms | 28 |
| Complexity | 425.0 |
Chemical Identifiers
| CAS Number | 6284-04-4 |
|---|---|
| SMILES | CCOC1=CC=CC=C1O[C@@H]([C@H]2CNCCO2)C3=CC=CC=C3.CS(=O)(=O)O |
| InChIKey | CGTZMJIMMUNLQD-STYNFMPRSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Reboxetine Mesylate (CAS 6284-04-4), with molecular formula C20H27NO6S and molecular weight 409.1559 g/mol. IUPAC: (2R)-2-[(R)-(2-ethoxyphenoxy)-phenylmethyl]morpholine;methanesulfonic acid.