4-(Trifluoromethylsulfonamido)benzoic acid
4-(trifluoromethylsulfonylamino)benzoic acid
Also Known As: 4-(trifluoromethylsulfonamido)benzoic acid|4-{[(trifluoromethyl)sulfonyl]amino}benzoic acid|4-(trifluoromethylsulfonylamino)benzoic acid|4-trifluoromethanesulfonamidobenzoic acid|4-(TRIFLUOROMETHANESULFONAMIDO)BENZOIC ACID|4-(trifluoromethylsulfonamido)benzoicacid|N-(4-carboxyphenyl)trifluoromethanesulfonamide|4-((trifluoromethyl)sulfonamido)benzoic acid|Benzoic acid, 4-[[(trifluoromethyl)sulfonyl]amino]-|819-866-3
| Molecular Formula | C8H6F3NO4S |
|---|---|
| Molecular Weight | 268.99695 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 91.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Exact Mass | 268.99695 |
| Monoisotopic Mass | 268.99695 |
| Heavy Atoms | 17 |
| Complexity | 379.0 |
Chemical Identifiers
| CAS Number | 6293-80-7 |
|---|---|
| SMILES | C1=CC(=CC=C1C(=O)O)NS(=O)(=O)C(F)(F)F |
| InChIKey | KSDPKHIFHRHXGJ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(Trifluoromethylsulfonamido)benzoic acid (CAS 6293-80-7), with molecular formula C8H6F3NO4S and molecular weight 268.99695 g/mol. IUPAC: 4-(trifluoromethylsulfonylamino)benzoic acid.