[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol
[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol
Also Known As: (S)-1,2,3,4-Tetrahydroisoquinoline-3-methanol|(S)-(1,2,3,4-Tetrahydroisoquinolin-3-yl)methanol|(3s)-1,2,3,4-tetrahydroisoquinolin-3-ylmethanol|[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol|Maybridge1_008972|ZSKDXMLMMQFHGW-JTQLQIEISA-|(S)-(-)-1,2,3,4-Tetrahydro-3-isoquinolinemethanol|HMS566P18|KST-1A6761|CT-816|FD1007|(S)-Tetrahydroisoquinolinyl-3-methanol|3-Isoquinolinemethanol, 1,2,3,4-tetrahydro-, (3S)-|CS-W014288|PS-6029|KS-0000097F|(S)-1,2,3,4-TETRAHYDROISOQUINOLIN-3-YL-METHANOL
| Molecular Formula | C10H13NO |
|---|---|
| Molecular Weight | 163.09972 g/mol |
| LogP | 0.7 |
| Topological Polar Surface Area | 32.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 163.09972 |
| Monoisotopic Mass | 163.09972 |
| Heavy Atoms | 12 |
| Complexity | 149.0 |
Chemical Identifiers
| CAS Number | 6299-40-7 |
|---|---|
| SMILES | C1[C@H](NCC2=CC=CC=C21)CO |
| InChIKey | ZSKDXMLMMQFHGW-JTQLQIEISA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol (CAS 6299-40-7), with molecular formula C10H13NO and molecular weight 163.09972 g/mol. IUPAC: [(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol.