O-(4-Bromo-2,5-dichlorophenyl) O-propyl methylphosphonothioate
(4-bromo-2,5-dichlorophenoxy)-methyl-propoxy-sulfanylidene-λ5-phosphane
Also Known As: OMS 1297|OMS-1297|AI3-27453|AI 3-27453|o-(4-bromo-2,5-dichlorophenyl) o-propyl methylphosphonothioate|O-(2,5-Dichloro-4-bromophenyl) O-propyl methylphosphonothioate|Phosphonothioic acid, methyl-, O-(4-bromo-2,5-dichlorophenyl) O-propyl ester|(4-bromo-2,5-dichlorophenoxy)-methyl-propoxy-sulfanylidene-|O-4-bromo-2,5-dichlorophenyl O-propyl methylphosphonothioate|Methylphosphonothioic acid O-(4-bromo-2,5-dichlorophenyl)O-propyl ester
| Molecular Formula | C10H12BrCl2O2PS |
|---|---|
| Molecular Weight | 375.88562 g/mol |
| LogP | 6.3 |
| Topological Polar Surface Area | 50.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 375.88562 |
| Monoisotopic Mass | 375.88562 |
| Heavy Atoms | 17 |
| Complexity | 295.0 |
Chemical Identifiers
| CAS Number | 6301-98-0 |
|---|---|
| SMILES | CCCOP(=S)(C)OC1=CC(=C(C=C1Cl)Br)Cl |
| InChIKey | BDDMQMAHOSOSQV-UHFFFAOYSA-N |
Product Overview
O-(4-Bromo-2,5-dichlorophenyl) O-propyl methylphosphonothioate (CAS 6301-98-0), with molecular formula C10H12BrCl2O2PS and molecular weight 375.88562 g/mol. IUPAC: (4-bromo-2,5-dichlorophenoxy)-methyl-propoxy-sulfanylidene-λ5-phosphane.