4-Amino-3,5-dibromobenzotrifluoride
2,6-dibromo-4-(trifluoromethyl)aniline
Also Known As: 2,6-Dibromo-4-(trifluoromethyl)aniline|4-Amino-3,5-dibromobenzotrifluoride|MECOPROP|ACMC-209ony|8-Fluoro-4-hydroxyquinoline|KS-00003QYL|BUTTPARK 29\06-99|2,6-DIBROMO-4- ANILINE|2,6-dibromo-4-trifluoromethyl aniline|PS-7054|2,6-dibromo-4-(trifluoromethyl)phenylamine|Benzenamine, 2,6-dibromo-4-(trifluoromethyl)-|2,6-Dibromo-4-trifluoromethyl-phenylamine|2,6-Dibromo-4-(trifluoromethyl)benzeneamine|4 - Amino - 3,5 - dibromobenzotrifluoride|2,6-Dibromo-4-(trifluoromethyl)aniline 97%
| Molecular Formula | C7H4Br2F3N |
|---|---|
| Molecular Weight | 316.86627 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 26.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 316.86627 |
| Monoisotopic Mass | 316.86627 |
| Heavy Atoms | 13 |
| Complexity | 173.0 |
Chemical Identifiers
| CAS Number | 63010-71-9 |
|---|---|
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(F)(F)F |
| InChIKey | DRSMEHXBOXHXDX-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Amino-3,5-dibromobenzotrifluoride (CAS 63010-71-9), with molecular formula C7H4Br2F3N and molecular weight 316.86627 g/mol. IUPAC: 2,6-dibromo-4-(trifluoromethyl)aniline.