Delanterone
(1S,8S,9S,10R,13R,14S)-1,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one
Also Known As: Delanterone|Delanterone [INN]|Delanterona|1alpha-Methylandrosta-4,16-dien-3-one|1alpha-Methylandrosta-4,16-dien-3-one.|1.ALPHA.-METHYLANDROSTA-4,16-DIEN-3-ONE|(1S,8S,9S,10R,13R,14S)-1,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one|(3aS,3bS,9S,9aR,9bS,11aR)-9,9a,11a-trimethyl-3H,3aH,3bH,4H,5H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-7-one
| Molecular Formula | C20H28O |
|---|---|
| Molecular Weight | 284.21402 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 284.21402 |
| Monoisotopic Mass | 284.21402 |
| Heavy Atoms | 21 |
| Complexity | 542.0 |
Chemical Identifiers
| CAS Number | 63014-96-0 |
|---|---|
| SMILES | C[C@H]1CC(=O)C=C2[C@]1([C@H]3CC[C@@]4(C=CC[C@H]4[C@@H]3CC2)C)C |
| InChIKey | GDONNNQFENTLQC-VWTPSIDOSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Delanterone (CAS 63014-96-0), with molecular formula C20H28O and molecular weight 284.21402 g/mol. IUPAC: (1S,8S,9S,10R,13R,14S)-1,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.