4-(Tert-butyl)-3-nitroaniline
4-tert-butyl-3-nitroaniline
Also Known As: 4-tert-butyl-3-nitroaniline|4-(tert-butyl)-3-nitroaniline|3-nitro-4-tert-butylaniline|3-Ntro-4-tert-butylaniline|4-tert-butyl-3-nitro-aniline|4-amino-2-nitro-t-butylbenzene|4-tert-butyl-3-nitro-phenylamine|4-(tert-butyl)-3-nitrophenylamine|Benzenamine, 4-(1,1-dimethylethyl)-3-nitro-|WT1547|31951-12-9 3-nitro-4-tert-butylaniline|4-tert-Butyl-3-nitro-phenylamine hydrochloride|Z-8047|AE-562/43099646|A1-10850|A3977/0169427|667-518-2
| Molecular Formula | C10H14N2O2 |
|---|---|
| Molecular Weight | 194.10553 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 71.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 194.10553 |
| Monoisotopic Mass | 194.10553 |
| Heavy Atoms | 14 |
| Complexity | 217.0 |
Chemical Identifiers
| CAS Number | 6310-20-9 |
|---|---|
| SMILES | CC(C)(C)C1=C(C=C(C=C1)N)[N+](=O)[O-] |
| InChIKey | KGBIPCNLIXXUQA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(Tert-butyl)-3-nitroaniline (CAS 6310-20-9), with molecular formula C10H14N2O2 and molecular weight 194.10553 g/mol. IUPAC: 4-tert-butyl-3-nitroaniline.
4-(Tert-butyl)-3-nitroaniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »