AC1O59L2
4-[(E)-2-[(E)-2-but-3-enoxyethenoxy]ethenoxy]but-1-ene;methyl prop-2-enoate;prop-2-enenitrile
Also Known As: (C8-H14-O3.C4-H6-O2.C3-H3-N)x-|Acrylonitrile, diethylene glycol divinylether, methyl acrylate polymer|2-Propenoic acid, methyl ester, polymer with 1,1'-[oxybis(2,1-ethanediyloxy)]bis[ethene] and 2-propenenitrile|2-Propenoic acid, methyl ester, polymer with 1,1'-(oxybis(2,1-ethanediyloxy))bis(ethene) and 2-propenenitrile|4-[(E)-2-[(E)-2-but-3-enoxyethenoxy]ethenoxy]but-1-ene; methyl prop-2-enoate; prop-2-enenitrile|4-[(E)-2-[(E)-2-but-3-enoxyethenoxy]ethenoxy]but-1-ene;methyl prop-2-enoate;prop-2-enenitrile
| Molecular Formula | C19H27NO5 |
|---|---|
| Molecular Weight | 349.18893 g/mol |
| LogP | 4.17218 |
| Topological Polar Surface Area | 77.78 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Exact Mass | 349.18893 |
| Monoisotopic Mass | 349.18893 |
| Heavy Atoms | 25 |
| Complexity | 425.22104 |
Chemical Identifiers
| CAS Number | 63149-77-9 |
|---|---|
| SMILES | COC(=O)C=C.C=CCCO/C=C/O/C=C/OCCC=C.C=CC#N |
Product Overview
AC1O59L2 (CAS 63149-77-9), with molecular formula C19H27NO5 and molecular weight 349.18893 g/mol. IUPAC: 4-[(E)-2-[(E)-2-but-3-enoxyethenoxy]ethenoxy]but-1-ene;methyl prop-2-enoate;prop-2-enenitrile.