2-Methylpropyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate
2-methylpropyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
Also Known As: Chrysanthemumsaeure-isobutylester|2-methylpropyl2,2-dimethyl-3- cyclopropane-1-carboxylate|2-Methylpropyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate|2-methylpropyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate|2-methylpropyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate|Cyclopropanecarboxylicacid, 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)-, 2-methylpropyl ester
| Molecular Formula | C14H24O2 |
|---|---|
| Molecular Weight | 224.17763 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 224.17763 |
| Monoisotopic Mass | 224.17763 |
| Heavy Atoms | 16 |
| Complexity | 296.0 |
Chemical Identifiers
| CAS Number | 6317-98-2 |
|---|---|
| SMILES | CC(C)COC(=O)C1C(C1(C)C)C=C(C)C |
| InChIKey | UNVYTKKTBBXIRW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Methylpropyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate (CAS 6317-98-2), with molecular formula C14H24O2 and molecular weight 224.17763 g/mol. IUPAC: 2-methylpropyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.