(E)-5-(2-Ethoxybenzylidene)-2-mercaptothiazol-4(5H)-one
(5E)-5-[(2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Also Known As: AKOS B018349|(5E)-5-(2-ethoxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one|ART-CHEM-BB B018349|(E)-5-(2-Ethoxybenzylidene)-2-mercaptothiazol-4(5H)-one|AB00092463-01|SR-01000216404-1|I01-13282|(5E)-5-[(2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one|(5E)-5-[(2-ethoxyphenyl)methylene]-2-thioxo-thiazolidin-4-one|(5Z)-5-(2-ethoxybenzylidene)-2-sulfanyl-1,3-thiazol-4(5H)-one|(5E)-5-[(2-ethoxyphenyl)methylidene]-2-sulfanyl-1,3-thiazol-4-one
| Molecular Formula | C12H11NO2S2 |
|---|---|
| Molecular Weight | 265.02313 g/mol |
| LogP | 2.5741 |
| Topological Polar Surface Area | 38.33 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 265.02313 |
| Monoisotopic Mass | 265.02313 |
| Heavy Atoms | 17 |
| Complexity | 497.03394 |
Chemical Identifiers
| CAS Number | 6319-50-2 |
|---|---|
| SMILES | CCOC1=CC=CC=C1/C=C/2\C(=O)NC(=S)S2 |
Product Overview
(E)-5-(2-Ethoxybenzylidene)-2-mercaptothiazol-4(5H)-one (CAS 6319-50-2), with molecular formula C12H11NO2S2 and molecular weight 265.02313 g/mol. IUPAC: (5E)-5-[(2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.