1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, 5-(p-chlorophenyl)-2-furoate
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 5-(4-chlorophenyl)furan-2-carboxylate
Also Known As: 5-21-01-00247 (Beilstein Handbook Reference)|1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, 5-(p-chlorophenyl)-2-furoate|2-Furoic acid, 5-(p-chlorophenyl)-, 1-alpha-H,5-alpha-H-tropan-3-alpha-yl ester|5-(p-Chlorophenylfuran)-2-carboxylic acid, 1-alpha-H,5-alpha-H-tropan-3-alpha-yl ester|(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 5-(4-chlorophenyl)furan-2-carboxylate|8-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-YL 5-(4-CHLOROPHENYL)FURAN-2-CARBOXYLATE
| Molecular Formula | C19H20ClNO3 |
|---|---|
| Molecular Weight | 345.11316 g/mol |
| LogP | 4.382 |
| Topological Polar Surface Area | 42.68 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 345.11316 |
| Monoisotopic Mass | 345.11316 |
| Heavy Atoms | 24 |
| Complexity | 725.32513 |
Chemical Identifiers
| CAS Number | 63191-89-9 |
|---|---|
| SMILES | CN1C2CCC1CC(C2)OC(=O)C3=CC=C(O3)C4=CC=C(C=C4)Cl |
Product Overview
1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, 5-(p-chlorophenyl)-2-furoate (CAS 63191-89-9), with molecular formula C19H20ClNO3 and molecular weight 345.11316 g/mol. IUPAC: (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 5-(4-chlorophenyl)furan-2-carboxylate.