Ethyl 2,3-dimethyl-3-phenyloxirane-2-carboxylate
ethyl 2,3-dimethyl-3-phenyloxirane-2-carboxylate
Also Known As: ethyl 2,3-dimethyl-3-phenyloxirane-2-carboxylate|J1.702.991F|ethyl(z)-2,3-dimethyl-3-phenyloxirane-2-carboxylate|Ethyl 2,3-dimethyl-3-phenyl-2-oxiranecarboxylate #|3-Phenyl-2-methyl-2,3-epoxy-buttersaeure-aethylester|Ethyl (Z)-2,3-dimethyl-3-phenyloxirane-2-carboxylate|Ethyl cis-2,3-dimethyl-3-phenyloxirane-2-carboxylate|2,3-Dimethyl-3-phenyloxirane-2-carboxylic acid ethyl ester
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.10994 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 38.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 220.10994 |
| Monoisotopic Mass | 220.10994 |
| Heavy Atoms | 16 |
| Complexity | 283.0 |
Chemical Identifiers
| CAS Number | 6325-47-9 |
|---|---|
| SMILES | CCOC(=O)C1(C(O1)(C)C2=CC=CC=C2)C |
| InChIKey | JPPCBYPJJZNXQS-UHFFFAOYSA-N |
Product Overview
Ethyl 2,3-dimethyl-3-phenyloxirane-2-carboxylate (CAS 6325-47-9), with molecular formula C13H16O3 and molecular weight 220.10994 g/mol. IUPAC: ethyl 2,3-dimethyl-3-phenyloxirane-2-carboxylate.
Ethyl 2,3-dimethyl-3-phenyloxirane-2-carboxylate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »