![5,6-Dimethyl-2-phenyl-4H-thieno[2,3-d][1,3]oxazin-4-one structure](/static/products/6327/63274-60-2.webp)
5,6-Dimethyl-2-phenyl-4H-thieno[2,3-d][1,3]oxazin-4-one
5,6-dimethyl-2-phenylthieno[2,3-d][1,3]oxazin-4-one
Also Known As: 5,6-Dimethyl-2-phenyl-4H-thieno[2,3-d][1,3]oxazin-4-one|ChemDiv1_011692|HMS620D10|BAS 01026393|5,6-dimethyl-2-phenylthieno[2,3-d][1,3]oxazin-4-one|5,6-Dimethyl-2-phenyl-thieno[2,3-d][1,3]oxazin-4-one|AH-262/01716062|SR-01000528067-1|5,6-dimethyl-2-phenylthiopheno[2,3-d]1,3-oxazin-4-one|A2186/0091929|5,6-Dimethyl-2-phenyl-4H-thieno[2,3-d][1,3]oxazin-4-one #
| Molecular Formula | C14H11NO2S |
|---|---|
| Molecular Weight | 257.05106 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 66.9 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 257.05106 |
| Monoisotopic Mass | 257.05106 |
| Heavy Atoms | 18 |
| Complexity | 376.0 |
Chemical Identifiers
| CAS Number | 63274-60-2 |
|---|---|
| SMILES | CC1=C(SC2=C1C(=O)OC(=N2)C3=CC=CC=C3)C |
| InChIKey | ATXBABRHIHRGAM-UHFFFAOYSA-N |
Product Overview
5,6-Dimethyl-2-phenyl-4H-thieno[2,3-d][1,3]oxazin-4-one (CAS 63274-60-2), with molecular formula C14H11NO2S and molecular weight 257.05106 g/mol. IUPAC: 5,6-dimethyl-2-phenylthieno[2,3-d][1,3]oxazin-4-one.
5,6-Dimethyl-2-phenyl-4H-thieno[2,3-d][1,3]oxazin-4-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »