4-(4-Methylbenzoyl)-1-indancarboxylic acid
4-(4-methylbenzoyl)-2,3-dihydro-1H-indene-1-carboxylic acid
Also Known As: Tai-908|4-(4-Methylbenzoyl)-1-indancarboxylic acid|4-Toluoyl-1-indancarbonsaeure|TAI 908|4-(p-Toluoyl)-1-indancarboxylic acid|TQP1438|1-Indancarboxylic acid, 4-(p-toluoyl)-|4-(4-methylbenzoyl)-2,3-dihydro-1H-indene-1-carboxylic acid|4-(p-Toluoyl)-1-indanecarboxylic acid|4-(4-methylbenzoyl)indane-1-carboxylic acid|1H-Indene-1-carboxylic acid, 2,3-dihydro-4-(4-methylbenzoyl)-|1H-Indene-1-carboxylicacid, 2,3-dihydro-4-(4-methylbenzoyl)-|2,3-Dihydro-4-(4-methylbenzoyl)-1H-indene-1-carboxylic acid
| Molecular Formula | C18H16O3 |
|---|---|
| Molecular Weight | 280.10995 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 54.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 280.10995 |
| Monoisotopic Mass | 280.10995 |
| Heavy Atoms | 21 |
| Complexity | 409.0 |
Chemical Identifiers
| CAS Number | 6345-77-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC3=C2CCC3C(=O)O |
| InChIKey | WZAJBIXBRFTJRC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(4-Methylbenzoyl)-1-indancarboxylic acid (CAS 6345-77-3), with molecular formula C18H16O3 and molecular weight 280.10995 g/mol. IUPAC: 4-(4-methylbenzoyl)-2,3-dihydro-1H-indene-1-carboxylic acid.