AH-487/15274065
5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione
Also Known As: AH-487/15274065|5-{4-[(2-chlorobenzyl)oxy]benzylidene}-1,3-dimethyl-2-thioxodihydro-4,6(1H,5H)-pyrimidinedione|5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione|5-({4-[(2-CHLOROPHENYL)METHOXY]PHENYL}METHYLIDENE)-1,3-DIMETHYL-2-SULFANYLIDENE-1,3-DIAZINANE-4,6-DIONE|5-{4-[(2-chlorobenzyl)oxy]benzylidene}-1,3-dimethyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione
| Molecular Formula | C20H17ClN2O3S |
|---|---|
| Molecular Weight | 400.06485 g/mol |
| LogP | 3.5177 |
| Topological Polar Surface Area | 49.85 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 400.06485 |
| Monoisotopic Mass | 400.06485 |
| Heavy Atoms | 27 |
| Complexity | 914.4979 |
Chemical Identifiers
| CAS Number | 6355-56-2 |
|---|---|
| SMILES | CN1C(=O)C(=CC2=CC=C(C=C2)OCC3=CC=CC=C3Cl)C(=O)N(C1=S)C |
Product Overview
AH-487/15274065 (CAS 6355-56-2), with molecular formula C20H17ClN2O3S and molecular weight 400.06485 g/mol. IUPAC: 5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.