Diiodotriphenylphosphorane
diiodo(triphenyl)-λ5-phosphane
Also Known As: Diiodotriphenylphosphorane|Triphenylphosphine diiodide|diiodo(triphenyl)-|N-Acetyl-D-tryptophan|Phosphorane, diiodotriphenyl-|Triphenyldiiodophosphorane|Phosphorane,diiodotriphenyl-|diiodo(triphenyl)-lambda5-phosphane|Iodotriphenylphosphoranium iodide|I2-PPh3|DIIDOTRIPHENYLPHOSPHORANE|diiodotriphenyl-lambda5-phosphane|diiodo(triphenyl)-|E5-phosphane|DIIODOTRIPHENYL-??-PHOSPHANE|AC9088|Diiodotri(phenyl)-lambda~5~-phosphane|TRIPHENYLPHOSINE DIIODIDE TECH. 90% 25G|4-16-00-01013 (Beilstein Handbook Reference)|Triphenylphosphine diiodide =90%, Technical Grade|TRIPHENYLPHOSPHINE DIIODIDE TECH. 90% 5G|Triphenylphosphine diiodide, technical grade, 90%|I14-53617|627-787-9
| Molecular Formula | C18H15I2P |
|---|---|
| Molecular Weight | 515.9001 g/mol |
| LogP | 6.3 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 515.9001 |
| Monoisotopic Mass | 515.9001 |
| Heavy Atoms | 21 |
| Complexity | 285.0 |
Chemical Identifiers
| CAS Number | 6396-07-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)(C3=CC=CC=C3)(I)I |
| InChIKey | NSWZEXJQHIXCFL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 13 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Diiodotriphenylphosphorane (CAS 6396-07-2), with molecular formula C18H15I2P and molecular weight 515.9001 g/mol. IUPAC: diiodo(triphenyl)-λ5-phosphane.