Phosphoric acid, 1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl dimethyl ester
[(E)-1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl] dimethyl phosphate
Also Known As: Shell SD-8949|SD 8949|ENT 27,019|AI3-27019|SD-8949|1-(2-Bromo-4,5-dichlorophenyl)-2-chlorovinyl dimethyl phosphate|Phosphoric acid, 1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl dimethyl ester|[(E)-1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl] dimethyl phosphate|Phosphoric acid, 1-(2-bromo-4,5-dichlorophenyl)-2-chlorovinyl dimethyl ester|1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl dimethyl phosphate|Phosphoric acid dimethyl 1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl ester|Phosphoric acid, 1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl dimethyl ester (9CI)
| Molecular Formula | C10H9BrCl3O4P |
|---|---|
| Molecular Weight | 407.84875 g/mol |
| LogP | 5.7106 |
| Topological Polar Surface Area | 44.76 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 407.84875 |
| Monoisotopic Mass | 407.84875 |
| Heavy Atoms | 19 |
| Complexity | 541.8215 |
Chemical Identifiers
| CAS Number | 6412-75-5 |
|---|---|
| SMILES | COP(=O)(OC)O/C(=C/Cl)/C1=CC(=C(C=C1Br)Cl)Cl |
Product Overview
Phosphoric acid, 1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl dimethyl ester (CAS 6412-75-5), with molecular formula C10H9BrCl3O4P and molecular weight 407.84875 g/mol. IUPAC: [(E)-1-(2-bromo-4,5-dichlorophenyl)-2-chloroethenyl] dimethyl phosphate.