(+)-Schisandrin B
(9R,10S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene
Also Known As: gomisin N|Isokadsuranin|Schizandrin B|Wuweizisu B|Deoxygomisin A|Schisandrin B|(+)-Schisandrin B|Gamma-schizandrin|gamma-Schisandrin|(-)-Gomisin N|schisanthenol|r-schizandrin|( )-Schisandrin B|(+)-gamma-Schizandrin|Gomisin G|Gomisin-G|Gomisin-N|GOMISINN|(+)-schizandrin B|(6R)-Gomisin N|(+)-gamma-schisandrin|(+/-)-y-schizandrin|(+/-)-gamma-schizandrin|tetramethoxy(dimethyl)[?]|.GAMMA.-SCHISANDRIN|.GAMMA.-SCHIZANDRIN|SCHISANDRIN B, (+/-)-|HY-N2267|HY-N6866
| Molecular Formula | C23H28O6 |
|---|---|
| Molecular Weight | 400.1886 g/mol |
| LogP | 5.1 |
| Topological Polar Surface Area | 55.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 400.1886 |
| Monoisotopic Mass | 400.1886 |
| Heavy Atoms | 29 |
| Complexity | 543.0 |
Chemical Identifiers
| CAS Number | 64121-95-5 |
|---|---|
| SMILES | C[C@H]1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C[C@H]1C)OC)OC)OC)OC)OCO3 |
| InChIKey | RTZKSTLPRTWFEV-OLZOCXBDSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(+)-Schisandrin B (CAS 64121-95-5), with molecular formula C23H28O6 and molecular weight 400.1886 g/mol. IUPAC: (9R,10S)-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene.
(+)-Schisandrin B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »