4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide
4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide
Also Known As: 4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzene|4-methyl-N-(4-methylphenyl)sulfonyl-N-phenethylbenzenesulfonamide|4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide|4-Methyl-N-(4-methylbenzene-1-sulfonyl)-N-(2-phenylethyl)benzene-1-sulfonamide
| Molecular Formula | C22H23NO4S2 |
|---|---|
| Molecular Weight | 429.10684 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 88.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 429.10684 |
| Monoisotopic Mass | 429.10684 |
| Heavy Atoms | 29 |
| Complexity | 649.0 |
Chemical Identifiers
| CAS Number | 64183-77-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CCC2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)C |
| InChIKey | RWIGLZMDSKKXJN-UHFFFAOYSA-N |
Product Overview
4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide (CAS 64183-77-3), with molecular formula C22H23NO4S2 and molecular weight 429.10684 g/mol. IUPAC: 4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide.
4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »