Ethyl 4-(4-(dimethylamino)benzylamino)benzoate
ethyl 4-[[4-(dimethylamino)phenyl]methylamino]benzoate
Also Known As: ChemDiv3_004286|Oprea1_413077|Ethyl 4-((4-(dimethylamino)benzyl)amino)benzoate|Benzoic acid, 4-[[[4-(dimethylamino)phenyl]methyl]amino]-, ethyl ester|ethyl 4-{[4-(dimethylamino)benzyl]amino}benzoate|IDI1_022196|ethyl 4-({[4-(dimethylamino)phenyl]methyl}amino)benzoate|ETHYL 4-(4-(DIMETHYLAMINO)BENZYLAMINO)BENZOATE|ethyl 4-[[4-(dimethylamino)phenyl]methylamino]benzoate|ethyl 4-[4-(dimethylamino)benzylamino]benzoate|ethyl 4-[(4-dimethylaminophenyl)methylamino]benzoate|SR-01000084033-1|668-279-7
| Molecular Formula | C18H22N2O2 |
|---|---|
| Molecular Weight | 298.16812 g/mol |
| LogP | 3.5414 |
| Topological Polar Surface Area | 41.57 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 298.16812 |
| Monoisotopic Mass | 298.16812 |
| Heavy Atoms | 22 |
| Complexity | 603.9892 |
Chemical Identifiers
| CAS Number | 64261-07-0 |
|---|---|
| SMILES | CCOC(=O)C1=CC=C(C=C1)NCC2=CC=C(C=C2)N(C)C |
Product Overview
Ethyl 4-(4-(dimethylamino)benzylamino)benzoate (CAS 64261-07-0), with molecular formula C18H22N2O2 and molecular weight 298.16812 g/mol. IUPAC: ethyl 4-[[4-(dimethylamino)phenyl]methylamino]benzoate.