N-(2-tosylaminobenzylidene)aniline
4-methyl-N-[2-(phenyliminomethyl)phenyl]benzenesulfonamide
Also Known As: 2-Tosylaminobenzylidenanilin|N-(2-tosylaminobenzylidene)aniline|CCNLGNRHQSDXHW-UHFFFAOYSA|N-Tosyl-2-(phenyliminomethyl)aniline|4-methyl-N-[2-(phenyliminomethyl)phenyl]benzenesulfonamide|(E)-4-Methyl-N-(2-((phenylimino)methyl)phenyl)benzenesulfonamide|4-methyl-N-{2-[(E)-(phenylimino)methyl]phenyl}benzenesulfonamide|4-methyl-N-{2-[(phenylimino)methyl]phenyl}benzene-1-sulfonamide|Benzenesulfonamide, 4-methyl-N-[2-[(phenylimino)methyl]phenyl]-|Benzenesulfonamide, 4-methyl-N-[2-[(E)-(phenylimino)methyl]phenyl]-
| Molecular Formula | C20H18N2O2S |
|---|---|
| Molecular Weight | 350.1089 g/mol |
| LogP | 4.54642 |
| Topological Polar Surface Area | 58.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 350.1089 |
| Monoisotopic Mass | 350.1089 |
| Heavy Atoms | 25 |
| Complexity | 979.7194 |
Chemical Identifiers
| CAS Number | 6468-13-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C=NC3=CC=CC=C3 |
Product Overview
N-(2-tosylaminobenzylidene)aniline (CAS 6468-13-9), with molecular formula C20H18N2O2S and molecular weight 350.1089 g/mol. IUPAC: 4-methyl-N-[2-(phenyliminomethyl)phenyl]benzenesulfonamide.
N-(2-tosylaminobenzylidene)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »