Dimecamine hydrobromide
N,N,2,3,3-pentamethylbicyclo[2.2.1]heptan-2-amine;hydrobromide
Also Known As: Dimecamine hydrobromide|N,N,2,3,3-Pentamethyl-2-norbornamine hydrobromide|2-Norbornamine, N,N,2,3,3-pentamethyl-, hydrobromide|Bicyclo(2.2.1)heptan-2-amine, N,N,2,3,3-pentamethyl-, hydrobromide|2-NORBORNANAMINE, N,N,2,3,3-PENTAMETHYL-, HYDROBROMIDE|BICYCLO(2.2.1)HEPTAN-2-AMINE, N,N,2,3,3-PENTAMETHYL-, HYDROBROMIDE (1:1)|N,N,2,2,3-pentamethylbicyclo[2.2.1]heptan-3-amine hydrobromide|N,N,2,3,3-Pentamethylbicyclo[2.2.1]heptan-2-amine--hydrogen bromide (1/1)
| Molecular Formula | C12H24BrN |
|---|---|
| Molecular Weight | 261.10922 g/mol |
| LogP | 3.3407 |
| Topological Polar Surface Area | 3.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 261.10922 |
| Monoisotopic Mass | 261.10922 |
| Heavy Atoms | 14 |
| Complexity | 219.0 |
Chemical Identifiers
| CAS Number | 6472-63-5 |
|---|---|
| SMILES | CC1(C2CCC(C2)C1(C)N(C)C)C.Br |
| InChIKey | JLCYKWACZFDYOT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Dimecamine hydrobromide (CAS 6472-63-5), with molecular formula C12H24BrN and molecular weight 261.10922 g/mol. IUPAC: N,N,2,3,3-pentamethylbicyclo[2.2.1]heptan-2-amine;hydrobromide.