7,9-Diphenyl-8H-cyclopenta[a]acenaphthylen-8-one
7,9-diphenylcyclopenta[a]acenaphthylen-8-one
Also Known As: Acecyclone|Acecyclon|7,9-Diphenyl-8H-cyclopenta[a]acenaphthylen-8-one|7,9-diphenylcyclopenta[a]acenaphthylen-8-one|7,9-diphenyl-8H-Cyclopent[a]acenaphthylen-8-one|7,9-diphenylcyclopenta[a]acenaphthylene-8-one|8H-Cyclopent[a]acenaphthylen-8-one,7,9-diphenyl-|8H-Cyclopent[a]acenaphthylen-8-one, 7,9-diphenyl-|7,9-Diphenyl-8H-cyclopenta(a)acenaphthylen-8-one|8H-Cyclopent(a)acenaphthylen-8-one, 7,9-diphenyl-|2,5-Diphenyl-3,4-(naphthalene-1,8-diyl)-2,4-cyclopentene-1-one
| Molecular Formula | C27H16O |
|---|---|
| Molecular Weight | 356.12012 g/mol |
| LogP | 5.8 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 356.12012 |
| Monoisotopic Mass | 356.12012 |
| Heavy Atoms | 28 |
| Complexity | 655.0 |
Chemical Identifiers
| CAS Number | 64800-83-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=C3C4=CC=CC5=C4C(=CC=C5)C3=C(C2=O)C6=CC=CC=C6 |
| InChIKey | QQGHPFDLUNMBGJ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
7,9-Diphenyl-8H-cyclopenta[a]acenaphthylen-8-one (CAS 64800-83-5), with molecular formula C27H16O and molecular weight 356.12012 g/mol. IUPAC: 7,9-diphenylcyclopenta[a]acenaphthylen-8-one.