Bis-trifluoromethyl Ethylphosphonate
2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane
Also Known As: Bis-trifluoromethyl Ethylphosphonate|bis-trifluoroethyl ethylphosphonate|BIS(2,2,2-TRIFLUOROETHYL) ETHYLPHOSPHONATE|BIS-(TRIFLUOROMETHYL) ETHYLPHOSPHONATE|2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane|J2.572.198E|Ethyl-phosphonic Acid Bis(2,2,2-trifluoroethyl) Ester|Phosphonic acid, ethyl-, bis(2,2,2-trifluoroethyl) ester|Ethylphosphonic acid bis(2,2,2-trifluoroethyl) ester|2-(ethyl-(2,2,2-trifluoroethoxy)phosphoryl)oxy-1,1,1-trifluoro-ethane|2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoro-ethane
| Molecular Formula | C6H9F6O3P |
|---|---|
| Molecular Weight | 274.01935 g/mol |
| LogP | 3.3572 |
| Topological Polar Surface Area | 35.53 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 274.01935 |
| Monoisotopic Mass | 274.01935 |
| Heavy Atoms | 16 |
| Complexity | 237.96994 |
Chemical Identifiers
| CAS Number | 650-16-8 |
|---|---|
| SMILES | CCP(=O)(OCC(F)(F)F)OCC(F)(F)F |
Product Overview
Bis-trifluoromethyl Ethylphosphonate (CAS 650-16-8), with molecular formula C6H9F6O3P and molecular weight 274.01935 g/mol. IUPAC: 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane.