AC1M3KZK
N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide
Also Known As: KS-00003ZCC|N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide|SR-01000280880-1|N-[[[2-(2-bromo-4-propan-2-ylphenoxy)-1-oxoethyl]hydrazo]-sulfanylidenemethyl]-2-furancarboxamide|N-({2-[(2-bromo-4-isopropylphenoxy)acetyl]hydrazino}carbonothioyl)-2-furamide|2-[2-bromo-4-(methylethyl)phenoxy]-N-{[(2-furylcarbonylamino)thioxomethyl]amin o}acetamide|N-[(2-{[2-bromo-4-(propan-2-yl)phenoxy]acetyl}hydrazinyl)carbonothioyl]furan-2-carboxamide
| Molecular Formula | C17H18BrN3O4S |
|---|---|
| Molecular Weight | 439.02014 g/mol |
| LogP | 2.88 |
| Topological Polar Surface Area | 92.6 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 439.02014 |
| Monoisotopic Mass | 439.02014 |
| Heavy Atoms | 26 |
| Complexity | 793.3106 |
Chemical Identifiers
| CAS Number | 650587-69-2 |
|---|---|
| SMILES | CC(C)C1=CC(=C(C=C1)OCC(=O)NNC(=S)NC(=O)C2=CC=CO2)Br |
Product Overview
AC1M3KZK (CAS 650587-69-2), with molecular formula C17H18BrN3O4S and molecular weight 439.02014 g/mol. IUPAC: N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide.