1-methyl-3-(thiophen-2-yl)-5-(trifluoromethyl)-1H-pyrazole
1-methyl-3-thiophen-2-yl-5-(trifluoromethyl)pyrazole
Also Known As: 1-methyl-3-(thiophen-2-yl)-5-(trifluoromethyl)-1H-pyrazole|1-Methyl-3-thien-2-yl-5-(trifluoromethyl)-1H-pyrazole|1-methyl-3-thiophen-2-yl-5-(trifluoromethyl)pyrazole|7W-0855|1-methyl-3-(2-thienyl)-5-(trifluoromethyl)-1h-pyrazole|1-methyl-3-(2-thienyl)-5-(trifluoromethyl)pyrazole|1-methyl-3-(thiophen-2-yl)-5-(trifluoromethyl)pyrazole|2-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene
| Molecular Formula | C9H7F3N2S |
|---|---|
| Molecular Weight | 232.0282 g/mol |
| LogP | 3.1674 |
| Topological Polar Surface Area | 17.82 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 232.0282 |
| Monoisotopic Mass | 232.0282 |
| Heavy Atoms | 15 |
| Complexity | 456.156 |
Chemical Identifiers
| CAS Number | 650615-64-8 |
|---|---|
| SMILES | CN1C(=CC(=N1)C2=CC=CS2)C(F)(F)F |
Product Overview
1-methyl-3-(thiophen-2-yl)-5-(trifluoromethyl)-1H-pyrazole (CAS 650615-64-8), with molecular formula C9H7F3N2S and molecular weight 232.0282 g/mol. IUPAC: 1-methyl-3-thiophen-2-yl-5-(trifluoromethyl)pyrazole.
1-methyl-3-(thiophen-2-yl)-5-(trifluoromethyl)-1H-pyrazole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »