1-Bromo-4-((4-chlorophenyl)sulfonyl)benzene
1-(4-bromophenyl)sulfonyl-4-chlorobenzene
Also Known As: 1-Bromo-4-((4-chlorophenyl)sulfonyl)benzene|1-(4-bromophenyl)sulfonyl-4-chlorobenzene|(4-Chlorophenyl)(4-bromophenyl) sulfone|Benzene, 1-bromo-4-[(4-chlorophenyl)sulfonyl]-|1-(4-bromobenzenesulfonyl)-4-chlorobenzene|1-(4-bromophenyl)sulfonyl-4-chloro-benzene|(4-bromo-phenyl)-(4-chloro-phenyl)-sulfone|1-[(4-bromophenyl)sulfonyl]-4-chlorobenzene|1-Bromo-4-[(4-chlorophenyl)sulfonyl]benzene|J3.394.000I|AE-562/12222079
| Molecular Formula | C12H8BrClO2S |
|---|---|
| Molecular Weight | 329.91168 g/mol |
| LogP | 3.9353 |
| Topological Polar Surface Area | 34.14 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 329.91168 |
| Monoisotopic Mass | 329.91168 |
| Heavy Atoms | 17 |
| Complexity | 567.0601 |
Chemical Identifiers
| CAS Number | 65082-45-3 |
|---|---|
| SMILES | C1=CC(=CC=C1S(=O)(=O)C2=CC=C(C=C2)Br)Cl |
Product Overview
1-Bromo-4-((4-chlorophenyl)sulfonyl)benzene (CAS 65082-45-3), with molecular formula C12H8BrClO2S and molecular weight 329.91168 g/mol. IUPAC: 1-(4-bromophenyl)sulfonyl-4-chlorobenzene.
1-Bromo-4-((4-chlorophenyl)sulfonyl)benzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »