Methyl 3,5-dimethoxyphenylacetate
methyl 2-(3,5-dimethoxyphenyl)acetate
Also Known As: methyl 2-(3,5-dimethoxyphenyl)acetate|3,5-dimethoxyphenylacetic acid methyl ester|methyl 3,5-dimethoxyphenylacetate|Methyl (3,5-dimethoxyphenyl)acetate|Benzeneacetic acid,3,5-dimethoxy-, methyl ester|CLZWNNSTRIEAMH-UHFFFAOYSA-|(3,5-Dimethoxyphenyl)acetic acid methyl ester|5263AH|METHYL-3,5-DIMETHOXYPHENYLACETATE|methyl2-(3,5-dimethoxyphenyl)acetate|Benzeneacetic acid, 3,5-dimethoxy-, methyl ester|Methyl (3,5-dimethoxyphenyl)acetate #|3,5-Dimethoxybenzeneacetic acid methyl ester|J1.802.596E|3,5-DIMETHOXYPHENYLACETICACIDMETHYLESTER|A-8043|Benzeneacetic acid,3,5-diMethoxy-,Methyl ester|(3,5-dimethoxy-phenyl)-acetic acid methyl ester|2-(3,5-Dimethoxyphenyl)acetic acid methyl ester|Acetic acid, 2-(3,5-dimethoxyphenyl)-, methyl ester|664-864-6
| Molecular Formula | C11H14O4 |
|---|---|
| Molecular Weight | 210.0892 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 44.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 210.0892 |
| Monoisotopic Mass | 210.0892 |
| Heavy Atoms | 15 |
| Complexity | 193.0 |
Chemical Identifiers
| CAS Number | 6512-32-9 |
|---|---|
| SMILES | COC1=CC(=CC(=C1)CC(=O)OC)OC |
| InChIKey | CLZWNNSTRIEAMH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 3,5-dimethoxyphenylacetate (CAS 6512-32-9), with molecular formula C11H14O4 and molecular weight 210.0892 g/mol. IUPAC: methyl 2-(3,5-dimethoxyphenyl)acetate.