Butanedioic acid, 2-dodecenyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:2)
bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-[(E)-dodec-1-enyl]butanedioic acid
Also Known As: EINECS 265-582-2|Succinic acid, dodecenyl-, triethanolamine salt (1:2)|Butanedioic acid, 2-dodecenyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:2)|Butanedioic acid, dodecenyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:2)|Dodecenylsuccinic acid, compound with 2,2',2''-nitrilotriethanol (1:2)|Butanedioic acid, dodecenyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:2)|2-[bis(2-hydroxyethyl)amino]ethanol; 2-[(E)-dodec-1-enyl]butanedioic acid|2-[(1E)-Dodec-1-en-1-yl]butanedioic acid--2,2',2''-nitrilotri(ethan-1-ol) (1/2)|Butanedioic acid, 2-dodecenyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:2)
| Molecular Formula | C28H58N2O10 |
|---|---|
| Molecular Weight | 582.4091 g/mol |
| LogP | 0.7795 |
| Topological Polar Surface Area | 202.46 Ų |
| Hydrogen Bond Donors | 8 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Exact Mass | 582.4091 |
| Monoisotopic Mass | 582.4091 |
| Heavy Atoms | 40 |
| Complexity | 520.67896 |
Chemical Identifiers
| CAS Number | 65166-21-4 |
|---|---|
| SMILES | CCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O.C(CO)N(CCO)CCO.C(CO)N(CCO)CCO |
Product Overview
Butanedioic acid, 2-dodecenyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:2) (CAS 65166-21-4), with molecular formula C28H58N2O10 and molecular weight 582.4091 g/mol. IUPAC: bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-[(E)-dodec-1-enyl]butanedioic acid.