1-(4-Isopropylphenyl)-2-thiourea
(4-propan-2-ylphenyl)thiourea
Also Known As: 1-(4-Isopropylphenyl)-2-thiourea|Lauryl bromide|N-(4-isopropylphenyl)thiourea|(4-propan-2-ylphenyl)thiourea|1-(4-Isopropylphenyl)thiourea|4-isopropylphenylthiourea|(4-isopropylphenyl)thiourea|[4-(propan-2-yl)phenyl]thiourea|(4-Isopropyl-phenyl)-thiourea|Thiourea,N-[4-(1-methylethyl)phenyl]-|1-(4-iso-propylphenyl)-2-thiourea|1-[4-(propan-2-yl)phenyl]thiourea|7458AE|N-[4-(Propan-2-yl)phenyl]thiourea|amino{[4-(methylethyl)phenyl]amino}methane-1-thione|I09-2391
| Molecular Formula | C10H14N2S |
|---|---|
| Molecular Weight | 194.08777 g/mol |
| LogP | 2.4655 |
| Topological Polar Surface Area | 38.05 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 194.08777 |
| Monoisotopic Mass | 194.08777 |
| Heavy Atoms | 13 |
| Complexity | 290.29797 |
Chemical Identifiers
| CAS Number | 65259-91-8 |
|---|---|
| SMILES | CC(C)C1=CC=C(C=C1)NC(=S)N |
Product Overview
1-(4-Isopropylphenyl)-2-thiourea (CAS 65259-91-8), with molecular formula C10H14N2S and molecular weight 194.08777 g/mol. IUPAC: (4-propan-2-ylphenyl)thiourea.
1-(4-Isopropylphenyl)-2-thiourea is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »