1,2,3,4,5-Pentafluoro-6-(methylsulfanyl)benzene
1,2,3,4,5-pentafluoro-6-methylsulfanylbenzene
Also Known As: Benzene, pentafluoro(methylthio)-|Pentafluorothioanisole|Methyl(perfluorophenyl)sulfane|Sulfide, methyl pentafluorophenyl|Methylpentafluorophenyl sulfide|Benzene,pentafluoro(methylthio)|Methyl pentafluorophenyl sulfide|Pentafluorophenyl methyl sulfide|1,2,3,4,5-Pentafluoro-6-(methylsulfanyl)benzene|1,2,3,4,5-pentafluoro-6-methylsulfanylbenzene|Methyl(pentafluorophenyl) sulfide|Benzene, 1,2,3,4,5-pentafluoro-6-(methylthio)-|1-(Methylthio)-2,3,4,5,6-pentafluorobenzene|1,2,3,4,5-pentafluoro-6-methylsulfanyl-benzene|1,2,3,4,5-Pentafluoro-6-(methylsulfanyl)benzene #|867-343-3|N/A
| Molecular Formula | C7H3F5S |
|---|---|
| Molecular Weight | 213.98756 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 25.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 213.98756 |
| Monoisotopic Mass | 213.98756 |
| Heavy Atoms | 13 |
| Complexity | 162.0 |
Chemical Identifiers
| CAS Number | 653-39-4 |
|---|---|
| SMILES | CSC1=C(C(=C(C(=C1F)F)F)F)F |
| InChIKey | NBOZXHXBHUVRNG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,2,3,4,5-Pentafluoro-6-(methylsulfanyl)benzene (CAS 653-39-4), with molecular formula C7H3F5S and molecular weight 213.98756 g/mol. IUPAC: 1,2,3,4,5-pentafluoro-6-methylsulfanylbenzene.